Benzenamine, 4-butoxy-N-[(4-ethoxy-1-naphthalenyl)methylene]-

Product Code: 1293309
Molecular Formula: C23H25NO2
Molecular Weight: 347.45
63057-93-2
63058-74-2 (1,2-Cyclohexanediamine)hydroxy platinum
608517-17-5 5-PyriMidinecarboxylic acid, 2-(trifluoroMethyl)-, Methyl ester
63055-90-3 Mg·O25P8
63057-81-8 1,3,2-Diazaphospholidine, 1,3-dimethyl-2-(1-methylpropoxy)-
608514-55-2 N-CYCLOPROPYL-TRANS-2-CIS-6-NONADIENAMIDE
60851-33-4 1-Butanone, 2-bromo-1-(4-chlorophenyl)-3,3-dimethyl-
6305-71-1 2,4-DIMETHYL-1-PENTANOL
608514-93-8 BENZONITRILE,3-(CYCLOPROPYLOXY)-4-HYDROXY-
63054-96-6 Hydrazinecarboxamide, 1-(1-ethenyl-2-propenyl)-N,2,2-trimethyl-
63059-42-7 5-chloro-2-[2-[(5-chlorobenzothiazol-2-yl)methylene]butylidene]-3-ethyl-2,3-dihydrobenzothiazole
63053-77-0 4(1H)-Quinazolinone, 2,3-dihydro-3-(methoxyphenyl)-2-thioxo-
608514-56-3 N-ETHYL(E)-2,(Z)-6-NONADIENAMIDE
63059-09-6 Carbamimidic chloride,N-(2-chloro-1-oxopropyl)-N,N'-bis(1-methylethyl)-
608515-72-6 5-ISOQUINOLINAMINE,6-FLUORO-
63057-96-5 Benzenamine, 4-butoxy-N-[[4-(pentyloxy)-1-naphthalenyl]methylene]-
6305-53-9 methyl 3-[3-(benzyloxy)-4-methoxyphenyl]propanoate
63055-74-3 Ca·O25P8
608516-04-7 Urea, N-[2-[4-(1,1-dimethylethyl)phenyl]ethyl]-N'-5-isoquinolinyl-
63057-93-2 Benzenamine, 4-butoxy-N-[(4-ethoxy-1-naphthalenyl)methylene]-
63056-03-1 Hexaphosphate, strontium (1:1)